![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Linear Programming.doc | 29-Oct-2004 13:21 | 24K | |
| Linear Programming.mw | 29-Oct-2004 13:21 | 84K | |
| Perm and Comb.mws | 29-Oct-2004 13:21 | 58K | |
| Probability Theory.doc | 29-Oct-2004 13:21 | 19K | |
| References for Linear Programming.doc | 29-Oct-2004 13:21 | 23K | |
| System of Equations.mw | 29-Oct-2004 13:21 | 226K | |
| Systems of Linear Equations.doc | 29-Oct-2004 13:21 | 19K | |
| surftilex/ | 19-Jan-2006 10:10 | - | |
| tilsurf/ | 19-Jan-2006 10:23 | - | |